About dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate
dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate (PubChem CID 156517019) has the molecular formula C13H15Br2NO5S
and a molecular weight of 457.14 g/mol. Its IUPAC name is dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate.
Molecular Properties
| Compound Name | dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate |
| PubChem CID | 156517019 |
| Molecular Formula | C13H15Br2NO5S |
| Molecular Weight | 457.14 g/mol |
| Exact Mass | 454.90 |
| IUPAC Name | dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)c1sc(Br)c(Br)c1C)C(=O)OC |
| InChI | InChI=1S/C13H15Br2NO5S/c1-6-9(14)11(15)22-10(6)12(18)16-7(13(19)21-3)4-5-8(17)20-2/h7H,4-5H2,1-3H3,(H,16,18)/t7-/m0/s1 |
| InChIKey | ZDZGKASNVGLLTI-ZETCQYMHSA-N |
| XLogP | 2.81 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate?
The IUPAC name of dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate (CID 156517019) is dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate.
What is the SMILES notation for dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate?
The canonical SMILES for dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate is COC(=O)CC[C@H](NC(=O)c1sc(Br)c(Br)c1C)C(=O)OC.
What is the InChIKey of dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate?
The InChIKey is ZDZGKASNVGLLTI-ZETCQYMHSA-N. The full InChI is InChI=1S/C13H15Br2NO5S/c1-6-9(14)11(15)22-10(6)12(18)16-7(13(19)21-3)4-5-8(17)20-2/h7H,4-5H2,1-3H3,(H,16,18)/t7-/m0/s1.
What are the key properties of dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate?
dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate has a molecular weight of 457.14 g/mol, XLogP of 2.81, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2S)-2-[(4,5-dibromo-3-methylthiophene-2-carbonyl)amino]pentanedioate is sourced from PubChem (CID 156517019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).