About [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate
[(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate (PubChem CID 156517137) has the molecular formula C25H28N2O2
and a molecular weight of 388.51 g/mol. Its IUPAC name is [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate.
Molecular Properties
| Compound Name | [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate |
| PubChem CID | 156517137 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate |
| SMILES | C=CC(C)C1(C(C)C=C)c2cc(N)ccc2-c2ccc(/C(C)=N\OC(C)=O)cc21 |
| InChI | InChI=1S/C25H28N2O2/c1-7-15(3)25(16(4)8-2)23-13-19(17(5)27-29-18(6)28)9-11-21(23)22-12-10-20(26)14-24(22)25/h7-16H,1-2,26H2,3-6H3/b27-17- |
| InChIKey | WZYNUQOTTKXSEQ-PKAZHMFMSA-N |
| XLogP | 5.47 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate?
The IUPAC name of [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate (CID 156517137) is [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate.
What is the SMILES notation for [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate?
The canonical SMILES for [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate is C=CC(C)C1(C(C)C=C)c2cc(N)ccc2-c2ccc(/C(C)=N\OC(C)=O)cc21.
What is the InChIKey of [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate?
The InChIKey is WZYNUQOTTKXSEQ-PKAZHMFMSA-N. The full InChI is InChI=1S/C25H28N2O2/c1-7-15(3)25(16(4)8-2)23-13-19(17(5)27-29-18(6)28)9-11-21(23)22-12-10-20(26)14-24(22)25/h7-16H,1-2,26H2,3-6H3/b27-17-.
What are the key properties of [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate?
[(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate has a molecular weight of 388.51 g/mol, XLogP of 5.47, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1-[7-amino-9,9-bis(but-3-en-2-yl)fluoren-2-yl]ethylideneamino] acetate is sourced from PubChem (CID 156517137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).