C24H25N5O2 — CID 156517139
3,8-dimethyl-N,2-bis(pyridin-2-ylmethyl)-3,3a,4,5-tetrahydrofuro[2,3-g]indazole-7-carboxamide (PubChem CID 156517139) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 3,8-dimethyl-N,2-bis(pyridin-2-ylmethyl)-3,3a,4,5-tetrahydrofuro[2,3-g]indazole-7-carboxamide.
| Compound Name | 3,8-dimethyl-N,2-bis(pyridin-2-ylmethyl)-3,3a,4,5-tetrahydrofuro[2,3-g]indazole-7-carboxamide |
|---|---|
| PubChem CID | 156517139 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3,8-dimethyl-N,2-bis(pyridin-2-ylmethyl)-3,3a,4,5-tetrahydrofuro[2,3-g]indazole-7-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccccn2)oc2c1C1=NN(Cc3ccccn3)C(C)C1CC2 |
| InChI | InChI=1S/C24H25N5O2/c1-15-21-20(31-23(15)24(30)27-13-17-7-3-5-11-25-17)10-9-19-16(2)29(28-22(19)21)14-18-8-4-6-12-26-18/h3-8,11-12,16,19H,9-10,13-14H2,1-2H3,(H,27,30) |
| InChIKey | SGWOKRGIPVFGGX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |