C18H16F3N3O3 — CID 156517153
[4-methyl-2-(pyridin-2-ylmethyl)-8-(trifluoromethyl)-4,5-dihydrofuro[2,3-g]indazol-7-yl]methanediol (PubChem CID 156517153) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is [4-methyl-2-(pyridin-2-ylmethyl)-8-(trifluoromethyl)-4,5-dihydrofuro[2,3-g]indazol-7-yl]methanediol.
| Compound Name | [4-methyl-2-(pyridin-2-ylmethyl)-8-(trifluoromethyl)-4,5-dihydrofuro[2,3-g]indazol-7-yl]methanediol |
|---|---|
| PubChem CID | 156517153 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [4-methyl-2-(pyridin-2-ylmethyl)-8-(trifluoromethyl)-4,5-dihydrofuro[2,3-g]indazol-7-yl]methanediol |
| SMILES | CC1Cc2oc(C(O)O)c(C(F)(F)F)c2-c2nn(Cc3ccccn3)cc21 |
| InChI | InChI=1S/C18H16F3N3O3/c1-9-6-12-13(14(18(19,20)21)16(27-12)17(25)26)15-11(9)8-24(23-15)7-10-4-2-3-5-22-10/h2-5,8-9,17,25-26H,6-7H2,1H3 |
| InChIKey | ZMDQRDIOVBKTNX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|