About 2,6-dimethyldiazepan-3-one
2,6-dimethyldiazepan-3-one (PubChem CID 156517271) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2,6-dimethyldiazepan-3-one.
Molecular Properties
| Compound Name | 2,6-dimethyldiazepan-3-one |
| PubChem CID | 156517271 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 2,6-dimethyldiazepan-3-one |
| SMILES | CC1CCC(=O)N(C)NC1 |
| InChI | InChI=1S/C7H14N2O/c1-6-3-4-7(10)9(2)8-5-6/h6,8H,3-5H2,1-2H3 |
| InChIKey | KSOCZRLSSRYWAA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyldiazepan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyldiazepan-3-one?
The IUPAC name of 2,6-dimethyldiazepan-3-one (CID 156517271) is 2,6-dimethyldiazepan-3-one.
What is the SMILES notation for 2,6-dimethyldiazepan-3-one?
The canonical SMILES for 2,6-dimethyldiazepan-3-one is CC1CCC(=O)N(C)NC1.
What is the InChIKey of 2,6-dimethyldiazepan-3-one?
The InChIKey is KSOCZRLSSRYWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-6-3-4-7(10)9(2)8-5-6/h6,8H,3-5H2,1-2H3.
What are the key properties of 2,6-dimethyldiazepan-3-one?
2,6-dimethyldiazepan-3-one has a molecular weight of 142.20 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyldiazepan-3-one is sourced from PubChem (CID 156517271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).