C25H33N3O6 — CID 156517566
N-[(6,6-dimethyl-1,4-dioxan-2-yl)methyl]-2-[[(2S)-1,4-dioxan-2-yl]methyl]-8-methylspiro[5H-furo[2,3-g]indazole-4,1'-cyclopropane]-7-carboxamide (PubChem CID 156517566) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[(6,6-dimethyl-1,4-dioxan-2-yl)methyl]-2-[[(2S)-1,4-dioxan-2-yl]methyl]-8-methylspiro[5H-furo[2,3-g]indazole-4,1'-cyclopropane]-7-carboxamide.
| Compound Name | N-[(6,6-dimethyl-1,4-dioxan-2-yl)methyl]-2-[[(2S)-1,4-dioxan-2-yl]methyl]-8-methylspiro[5H-furo[2,3-g]indazole-4,1'-cyclopropane]-7-carboxamide |
|---|---|
| PubChem CID | 156517566 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[(6,6-dimethyl-1,4-dioxan-2-yl)methyl]-2-[[(2S)-1,4-dioxan-2-yl]methyl]-8-methylspiro[5H-furo[2,3-g]indazole-4,1'-cyclopropane]-7-carboxamide |
| SMILES | Cc1c(C(=O)NCC2COCC(C)(C)O2)oc2c1-c1nn(C[C@H]3COCCO3)cc1C1(CC1)C2 |
| InChI | InChI=1S/C25H33N3O6/c1-15-20-19(33-22(15)23(29)26-9-16-12-31-14-24(2,3)34-16)8-25(4-5-25)18-11-28(27-21(18)20)10-17-13-30-6-7-32-17/h11,16-17H,4-10,12-14H2,1-3H3,(H,26,29)/t16?,17-/m0/s1 |
| InChIKey | WFXLTSMHRCXRON-DJNXLDHESA-N |
| XLogP | 2.38 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |