C22H27F2N3O6 — CID 156517584
8-(1,1-difluoroethyl)-N,2-bis[[(2S)-1,4-dioxan-2-yl]methyl]-4,5-dihydrofuro[2,3-g]indazole-7-carboxamide (PubChem CID 156517584) has the molecular formula C22H27F2N3O6 and a molecular weight of 467.47 g/mol. Its IUPAC name is 8-(1,1-difluoroethyl)-N,2-bis[[(2S)-1,4-dioxan-2-yl]methyl]-4,5-dihydrofuro[2,3-g]indazole-7-carboxamide.
| Compound Name | 8-(1,1-difluoroethyl)-N,2-bis[[(2S)-1,4-dioxan-2-yl]methyl]-4,5-dihydrofuro[2,3-g]indazole-7-carboxamide |
|---|---|
| PubChem CID | 156517584 |
| Molecular Formula | C22H27F2N3O6 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 8-(1,1-difluoroethyl)-N,2-bis[[(2S)-1,4-dioxan-2-yl]methyl]-4,5-dihydrofuro[2,3-g]indazole-7-carboxamide |
| SMILES | CC(F)(F)c1c(C(=O)NC[C@H]2COCCO2)oc2c1-c1nn(C[C@H]3COCCO3)cc1CC2 |
| InChI | InChI=1S/C22H27F2N3O6/c1-22(23,24)18-17-16(33-20(18)21(28)25-8-14-11-29-4-6-31-14)3-2-13-9-27(26-19(13)17)10-15-12-30-5-7-32-15/h9,14-15H,2-8,10-12H2,1H3,(H,25,28)/t14-,15-/m0/s1 |
| InChIKey | YDMAGRYFBRDNIZ-GJZGRUSLSA-N |
| XLogP | 1.91 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |