C16H18N4O3 — CID 156517703
2-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-8-methyl-4,5-dihydrofuro[2,3-g]indazole-7-carboxylic acid (PubChem CID 156517703) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-8-methyl-4,5-dihydrofuro[2,3-g]indazole-7-carboxylic acid.
| Compound Name | 2-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-8-methyl-4,5-dihydrofuro[2,3-g]indazole-7-carboxylic acid |
|---|---|
| PubChem CID | 156517703 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-8-methyl-4,5-dihydrofuro[2,3-g]indazole-7-carboxylic acid |
| SMILES | Cc1c(C(=O)O)oc2c1-c1nn(C/C(N)=C/C=C\N)cc1CC2 |
| InChI | InChI=1S/C16H18N4O3/c1-9-13-12(23-15(9)16(21)22)5-4-10-7-20(19-14(10)13)8-11(18)3-2-6-17/h2-3,6-7H,4-5,8,17-18H2,1H3,(H,21,22)/b6-2-,11-3- |
| InChIKey | BIOIOCIRFBPCTQ-HGPKVDOPSA-N |
| XLogP | 1.56 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|