C22H40F2N2 — CID 156517873
3,3-difluoro-4-propan-2-yl-1-[5-(4-propan-2-yl-3,6-dihydro-2H-pyridin-1-yl)hexan-2-yl]piperidine (PubChem CID 156517873) has the molecular formula C22H40F2N2 and a molecular weight of 370.57 g/mol. Its IUPAC name is 3,3-difluoro-4-propan-2-yl-1-[5-(4-propan-2-yl-3,6-dihydro-2H-pyridin-1-yl)hexan-2-yl]piperidine.
| Compound Name | 3,3-difluoro-4-propan-2-yl-1-[5-(4-propan-2-yl-3,6-dihydro-2H-pyridin-1-yl)hexan-2-yl]piperidine |
|---|---|
| PubChem CID | 156517873 |
| Molecular Formula | C22H40F2N2 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | 3,3-difluoro-4-propan-2-yl-1-[5-(4-propan-2-yl-3,6-dihydro-2H-pyridin-1-yl)hexan-2-yl]piperidine |
| SMILES | CC(C)C1=CCN(C(C)CCC(C)N2CCC(C(C)C)C(F)(F)C2)CC1 |
| InChI | InChI=1S/C22H40F2N2/c1-16(2)20-9-12-25(13-10-20)18(5)7-8-19(6)26-14-11-21(17(3)4)22(23,24)15-26/h9,16-19,21H,7-8,10-15H2,1-6H3 |
| InChIKey | XEYZHENMBIBTMQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|