C24H30N6O2S — CID 156518523
N-methyl-1-[1-[1-[2-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]-4-pyridinyl]indazol-6-yl]cyclobutyl]methanimine (PubChem CID 156518523) has the molecular formula C24H30N6O2S and a molecular weight of 466.61 g/mol. Its IUPAC name is N-methyl-1-[1-[1-[2-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]-4-pyridinyl]indazol-6-yl]cyclobutyl]methanimine.
| Compound Name | N-methyl-1-[1-[1-[2-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]-4-pyridinyl]indazol-6-yl]cyclobutyl]methanimine |
|---|---|
| PubChem CID | 156518523 |
| Molecular Formula | C24H30N6O2S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-methyl-1-[1-[1-[2-[(3S)-3-methyl-4-methylsulfonylpiperazin-1-yl]-4-pyridinyl]indazol-6-yl]cyclobutyl]methanimine |
| SMILES | C/N=C/C1(c2ccc3cnn(-c4ccnc(N5CCN(S(C)(=O)=O)[C@@H](C)C5)c4)c3c2)CCC1 |
| InChI | InChI=1S/C24H30N6O2S/c1-18-16-28(11-12-29(18)33(3,31)32)23-14-21(7-10-26-23)30-22-13-20(6-5-19(22)15-27-30)24(17-25-2)8-4-9-24/h5-7,10,13-15,17-18H,4,8-9,11-12,16H2,1-3H3/b25-17+/t18-/m0/s1 |
| InChIKey | RPIWMAAZPUBXMQ-WLXKGNRNSA-N |
| XLogP | 3.01 |
| TPSA | 83.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|