About (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol
(6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol (PubChem CID 156518659) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol.
Molecular Properties
| Compound Name | (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol |
| PubChem CID | 156518659 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol |
| SMILES | COc1cc2c(cc1CO)CN(C)N2C |
| InChI | InChI=1S/C11H16N2O2/c1-12-6-8-4-9(7-14)11(15-3)5-10(8)13(12)2/h4-5,14H,6-7H2,1-3H3 |
| InChIKey | QWQHVOGAYNABAR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol?
The IUPAC name of (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol (CID 156518659) is (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol.
What is the SMILES notation for (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol?
The canonical SMILES for (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol is COc1cc2c(cc1CO)CN(C)N2C.
What is the InChIKey of (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol?
The InChIKey is QWQHVOGAYNABAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-12-6-8-4-9(7-14)11(15-3)5-10(8)13(12)2/h4-5,14H,6-7H2,1-3H3.
What are the key properties of (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol?
(6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol has a molecular weight of 208.26 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxy-1,2-dimethyl-3H-indazol-5-yl)methanol is sourced from PubChem (CID 156518659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).