About [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol
[2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol (PubChem CID 156518758) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol.
Molecular Properties
| Compound Name | [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol |
| PubChem CID | 156518758 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol |
| SMILES | OCc1ccc2nc(C3CCOCC3)cn2n1 |
| InChI | InChI=1S/C12H15N3O2/c16-8-10-1-2-12-13-11(7-15(12)14-10)9-3-5-17-6-4-9/h1-2,7,9,16H,3-6,8H2 |
| InChIKey | RWDWBARVNQRPDA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol?
The IUPAC name of [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol (CID 156518758) is [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol.
What is the SMILES notation for [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol?
The canonical SMILES for [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol is OCc1ccc2nc(C3CCOCC3)cn2n1.
What is the InChIKey of [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol?
The InChIKey is RWDWBARVNQRPDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c16-8-10-1-2-12-13-11(7-15(12)14-10)9-3-5-17-6-4-9/h1-2,7,9,16H,3-6,8H2.
What are the key properties of [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol?
[2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol has a molecular weight of 233.27 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(oxan-4-yl)imidazo[1,2-b]pyridazin-6-yl]methanol is sourced from PubChem (CID 156518758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).