About [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane
[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane (PubChem CID 15651909) has the molecular formula C11H17F3O
and a molecular weight of 222.25 g/mol. Its IUPAC name is [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane.
Molecular Properties
| Compound Name | [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane |
| PubChem CID | 15651909 |
| Molecular Formula | C11H17F3O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane |
| SMILES | CCO/C(=C\C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H17F3O/c1-2-15-10(11(12,13)14)8-9-6-4-3-5-7-9/h8-9H,2-7H2,1H3/b10-8- |
| InChIKey | XUECCYHQDCVMAA-NTMALXAHSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane?
The IUPAC name of [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane (CID 15651909) is [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane.
What is the SMILES notation for [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane?
The canonical SMILES for [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane is CCO/C(=C\C1CCCCC1)C(F)(F)F.
What is the InChIKey of [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane?
The InChIKey is XUECCYHQDCVMAA-NTMALXAHSA-N. The full InChI is InChI=1S/C11H17F3O/c1-2-15-10(11(12,13)14)8-9-6-4-3-5-7-9/h8-9H,2-7H2,1H3/b10-8-.
What are the key properties of [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane?
[(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane has a molecular weight of 222.25 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]cyclohexane is sourced from PubChem (CID 15651909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).