C18H25N3O4S2 — CID 156519229
1-N-[2-(diethylamino)phenyl]-4-N,4-N-dimethylbenzene-1,4-disulfonamide (PubChem CID 156519229) has the molecular formula C18H25N3O4S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-N-[2-(diethylamino)phenyl]-4-N,4-N-dimethylbenzene-1,4-disulfonamide.
| Compound Name | 1-N-[2-(diethylamino)phenyl]-4-N,4-N-dimethylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 156519229 |
| Molecular Formula | C18H25N3O4S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-N-[2-(diethylamino)phenyl]-4-N,4-N-dimethylbenzene-1,4-disulfonamide |
| SMILES | CCN(CC)c1ccccc1NS(=O)(=O)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O4S2/c1-5-21(6-2)18-10-8-7-9-17(18)19-26(22,23)15-11-13-16(14-12-15)27(24,25)20(3)4/h7-14,19H,5-6H2,1-4H3 |
| InChIKey | YLGBIJFWLRGRFS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |