C18H26N2O2 — CID 156519247
(6-tert-butyl-1,6-diazaspiro[2.5]octan-1-yl)-(4-methoxyphenyl)methanone (PubChem CID 156519247) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (6-tert-butyl-1,6-diazaspiro[2.5]octan-1-yl)-(4-methoxyphenyl)methanone.
| Compound Name | (6-tert-butyl-1,6-diazaspiro[2.5]octan-1-yl)-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 156519247 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (6-tert-butyl-1,6-diazaspiro[2.5]octan-1-yl)-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CC23CCN(C(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C18H26N2O2/c1-17(2,3)19-11-9-18(10-12-19)13-20(18)16(21)14-5-7-15(22-4)8-6-14/h5-8H,9-13H2,1-4H3 |
| InChIKey | OEUIFBGVLQBETH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|