C11H15N3O3S — CID 156520065
methyl 2-[(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1,3-thiazole-5-carboxylate (PubChem CID 156520065) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is methyl 2-[(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 156520065 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | methyl 2-[(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(N2C[C@@H]3NCCO[C@@H]3C2)s1 |
| InChI | InChI=1S/C11H15N3O3S/c1-16-10(15)9-4-13-11(18-9)14-5-7-8(6-14)17-3-2-12-7/h4,7-8,12H,2-3,5-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | OLQFIOWBPCCIPJ-JGVFFNPUSA-N |
| XLogP | 0.11 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |