C25H24ClFN4O3 — CID 156520738
8-(3-chloro-5-fluorophenyl)-4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (PubChem CID 156520738) has the molecular formula C25H24ClFN4O3 and a molecular weight of 482.94 g/mol. Its IUPAC name is 8-(3-chloro-5-fluorophenyl)-4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one.
| Compound Name | 8-(3-chloro-5-fluorophenyl)-4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 156520738 |
| Molecular Formula | C25H24ClFN4O3 |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 8-(3-chloro-5-fluorophenyl)-4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-10-oxa-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(c2nc(=O)n3c4c(c(-c5cc(F)cc(Cl)c5)ccc24)OCC3)C[C@H]1C |
| InChI | InChI=1S/C25H24ClFN4O3/c1-4-21(32)30-12-15(3)31(13-14(30)2)24-20-6-5-19(16-9-17(26)11-18(27)10-16)23-22(20)29(7-8-34-23)25(33)28-24/h4-6,9-11,14-15H,1,7-8,12-13H2,2-3H3/t14-,15+/m1/s1 |
| InChIKey | VPDRBFYHTDKRBO-CABCVRRESA-N |
| XLogP | 3.86 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|