C27H28O2 — CID 156522122
2-[4-[3-(1-cyclopentyl-1H-inden-5-yl)cyclopenta-1,3-dien-1-yl]phenyl]ethane-1,1-diol (PubChem CID 156522122) has the molecular formula C27H28O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[4-[3-(1-cyclopentyl-1H-inden-5-yl)cyclopenta-1,3-dien-1-yl]phenyl]ethane-1,1-diol.
| Compound Name | 2-[4-[3-(1-cyclopentyl-1H-inden-5-yl)cyclopenta-1,3-dien-1-yl]phenyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 156522122 |
| Molecular Formula | C27H28O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 2-[4-[3-(1-cyclopentyl-1H-inden-5-yl)cyclopenta-1,3-dien-1-yl]phenyl]ethane-1,1-diol |
| SMILES | OC(O)Cc1ccc(C2=CC(c3ccc4c(c3)C=CC4C3CCCC3)=CC2)cc1 |
| InChI | InChI=1S/C27H28O2/c28-27(29)15-18-5-7-19(8-6-18)21-9-10-22(16-21)23-11-13-26-24(17-23)12-14-25(26)20-3-1-2-4-20/h5-8,10-14,16-17,20,25,27-29H,1-4,9,15H2 |
| InChIKey | QSQHRPPOUWKAEO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|