C16H9F2I3O5 — CID 156523041
2,2-difluoro-3-(4-hydroxyphenyl)-3-(2,3,5-triiodobenzoyl)oxypropanoic acid (PubChem CID 156523041) has the molecular formula C16H9F2I3O5 and a molecular weight of 699.95 g/mol. Its IUPAC name is 2,2-difluoro-3-(4-hydroxyphenyl)-3-(2,3,5-triiodobenzoyl)oxypropanoic acid.
| Compound Name | 2,2-difluoro-3-(4-hydroxyphenyl)-3-(2,3,5-triiodobenzoyl)oxypropanoic acid |
|---|---|
| PubChem CID | 156523041 |
| Molecular Formula | C16H9F2I3O5 |
| Molecular Weight | 699.95 g/mol |
| Exact Mass | 699.76 |
| IUPAC Name | 2,2-difluoro-3-(4-hydroxyphenyl)-3-(2,3,5-triiodobenzoyl)oxypropanoic acid |
| SMILES | O=C(OC(c1ccc(O)cc1)C(F)(F)C(=O)O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C16H9F2I3O5/c17-16(18,15(24)25)13(7-1-3-9(22)4-2-7)26-14(23)10-5-8(19)6-11(20)12(10)21/h1-6,13,22H,(H,24,25) |
| InChIKey | BAIFLIOOPZDHCW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.95 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|