About methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate
methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate (PubChem CID 156523826) has the molecular formula C9H8Cl3NO3S
and a molecular weight of 316.59 g/mol. Its IUPAC name is methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate |
| PubChem CID | 156523826 |
| Molecular Formula | C9H8Cl3NO3S |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 314.93 |
| IUPAC Name | methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)c1sc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl3NO3S/c1-3(9(15)16-2)13-8(14)6-4(10)5(11)7(12)17-6/h3H,1-2H3,(H,13,14)/t3-/m0/s1 |
| InChIKey | VZSTXIZRTSNOPN-VKHMYHEASA-N |
| XLogP | 3.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate?
The IUPAC name of methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate (CID 156523826) is methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate.
What is the SMILES notation for methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate?
The canonical SMILES for methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate is COC(=O)[C@H](C)NC(=O)c1sc(Cl)c(Cl)c1Cl.
What is the InChIKey of methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate?
The InChIKey is VZSTXIZRTSNOPN-VKHMYHEASA-N. The full InChI is InChI=1S/C9H8Cl3NO3S/c1-3(9(15)16-2)13-8(14)6-4(10)5(11)7(12)17-6/h3H,1-2H3,(H,13,14)/t3-/m0/s1.
What are the key properties of methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate?
methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate has a molecular weight of 316.59 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]propanoate is sourced from PubChem (CID 156523826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).