C40H52N4O8 — CID 156524019
2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-2-yl]cyclobutane-1,3-diol (PubChem CID 156524019) has the molecular formula C40H52N4O8 and a molecular weight of 716.88 g/mol. Its IUPAC name is 2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-2-yl]cyclobutane-1,3-diol.
| Compound Name | 2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-2-yl]cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 156524019 |
| Molecular Formula | C40H52N4O8 |
| Molecular Weight | 716.88 g/mol |
| Exact Mass | 716.38 |
| IUPAC Name | 2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-2-yl]cyclobutane-1,3-diol |
| SMILES | COCCOCCOCCn1c(/C=C/c2ccncc2)ccc1C1C(O)C(c2ccc(/C=C/c3ccncc3)n2CCOCCOCCOC)C1O |
| InChI | InChI=1S/C40H52N4O8/c1-47-23-25-51-29-27-49-21-19-43-33(5-3-31-11-15-41-16-12-31)7-9-35(43)37-39(45)38(40(37)46)36-10-8-34(6-4-32-13-17-42-18-14-32)44(36)20-22-50-28-30-52-26-24-48-2/h3-18,37-40,45-46H,19-30H2,1-2H3/b5-3+,6-4+ |
| InChIKey | KZLKPDXWGGYWBW-GGWOSOGESA-N |
| XLogP | 4.38 |
| TPSA | 131.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|