C28H32N8O — CID 156524054
1-(7-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-6-(4-piperazin-1-ylanilino)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 156524054) has the molecular formula C28H32N8O and a molecular weight of 496.62 g/mol. Its IUPAC name is 1-(7-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-6-(4-piperazin-1-ylanilino)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(7-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-6-(4-piperazin-1-ylanilino)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 156524054 |
| Molecular Formula | C28H32N8O |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 1-(7-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-6-(4-piperazin-1-ylanilino)-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCNCC4)cc3)nc2n1-c1ccc2c(n1)C(CC)CC2 |
| InChI | InChI=1S/C28H32N8O/c1-3-15-35-27(37)23-18-30-28(31-21-8-10-22(11-9-21)34-16-13-29-14-17-34)33-26(23)36(35)24-12-7-20-6-5-19(4-2)25(20)32-24/h3,7-12,18-19,29H,1,4-6,13-17H2,2H3,(H,30,31,33) |
| InChIKey | UBKIHCSSHPODGW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|