C10H12N2O — CID 156524070
6,6-dimethyl-1,2-dihydropyrrolo[3,4-c]azepin-3-one (PubChem CID 156524070) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 6,6-dimethyl-1,2-dihydropyrrolo[3,4-c]azepin-3-one.
| Compound Name | 6,6-dimethyl-1,2-dihydropyrrolo[3,4-c]azepin-3-one |
|---|---|
| PubChem CID | 156524070 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 6,6-dimethyl-1,2-dihydropyrrolo[3,4-c]azepin-3-one |
| SMILES | CC1(C)C=CC2=C(C=N1)C(=O)NC2 |
| InChI | InChI=1S/C10H12N2O/c1-10(2)4-3-7-5-11-9(13)8(7)6-12-10/h3-4,6H,5H2,1-2H3,(H,11,13) |
| InChIKey | VEJRFRQBXDLCRM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |