About tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate
tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate (PubChem CID 156524124) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate |
| PubChem CID | 156524124 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate |
| SMILES | Cc1ncc(N2C[C@@H](C)N(C(=O)OC(C)(C)C)[C@@H](C)C2)cn1 |
| InChI | InChI=1S/C16H26N4O2/c1-11-9-19(14-7-17-13(3)18-8-14)10-12(2)20(11)15(21)22-16(4,5)6/h7-8,11-12H,9-10H2,1-6H3/t11-,12+ |
| InChIKey | YKYFLRLAHBFQOC-TXEJJXNPSA-N |
| XLogP | 2.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate?
The IUPAC name of tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate (CID 156524124) is tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate is Cc1ncc(N2C[C@@H](C)N(C(=O)OC(C)(C)C)[C@@H](C)C2)cn1.
What is the InChIKey of tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate?
The InChIKey is YKYFLRLAHBFQOC-TXEJJXNPSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-11-9-19(14-7-17-13(3)18-8-14)10-12(2)20(11)15(21)22-16(4,5)6/h7-8,11-12H,9-10H2,1-6H3/t11-,12+.
What are the key properties of tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate?
tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate has a molecular weight of 306.41 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,6R)-2,6-dimethyl-4-(2-methylpyrimidin-5-yl)piperazine-1-carboxylate is sourced from PubChem (CID 156524124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).