C12H14FNO — CID 156524157
[(1R)-1-(4-fluoro-2,3-dimethylphenyl)propyl] cyanate (PubChem CID 156524157) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is [(1R)-1-(4-fluoro-2,3-dimethylphenyl)propyl] cyanate.
| Compound Name | [(1R)-1-(4-fluoro-2,3-dimethylphenyl)propyl] cyanate |
|---|---|
| PubChem CID | 156524157 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | [(1R)-1-(4-fluoro-2,3-dimethylphenyl)propyl] cyanate |
| SMILES | CC[C@@H](OC#N)c1ccc(F)c(C)c1C |
| InChI | InChI=1S/C12H14FNO/c1-4-12(15-7-14)10-5-6-11(13)9(3)8(10)2/h5-6,12H,4H2,1-3H3/t12-/m1/s1 |
| InChIKey | SIUWLLVMVPZJFV-GFCCVEGCSA-N |
| XLogP | 3.39 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|