C23H21F4N5O2 — CID 156524972
[6-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-3-[2-(2,3,5,6-tetrafluorophenyl)ethynyl]-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol (PubChem CID 156524972) has the molecular formula C23H21F4N5O2 and a molecular weight of 475.45 g/mol. Its IUPAC name is [6-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-3-[2-(2,3,5,6-tetrafluorophenyl)ethynyl]-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol.
| Compound Name | [6-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-3-[2-(2,3,5,6-tetrafluorophenyl)ethynyl]-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol |
|---|---|
| PubChem CID | 156524972 |
| Molecular Formula | C23H21F4N5O2 |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [6-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]-3-[2-(2,3,5,6-tetrafluorophenyl)ethynyl]-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol |
| SMILES | C[C@H]1CC2(CCN(c3nc4n[nH]c(C#Cc5c(F)c(F)cc(F)c5F)c4nc3CO)CC2)CO1 |
| InChI | InChI=1S/C23H21F4N5O2/c1-12-9-23(11-34-12)4-6-32(7-5-23)22-17(10-33)28-20-16(30-31-21(20)29-22)3-2-13-18(26)14(24)8-15(25)19(13)27/h8,12,33H,4-7,9-11H2,1H3,(H,29,30,31)/t12-/m0/s1 |
| InChIKey | CXZBWVRWAKWYEI-LBPRGKRZSA-N |
| XLogP | 3.20 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|