C15H13F3N4O3 — CID 156525523
(E)-3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-[2-(3-fluorophenoxy)ethyl]-4-iminobut-2-enamide (PubChem CID 156525523) has the molecular formula C15H13F3N4O3 and a molecular weight of 354.29 g/mol. Its IUPAC name is (E)-3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-[2-(3-fluorophenoxy)ethyl]-4-iminobut-2-enamide.
| Compound Name | (E)-3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-[2-(3-fluorophenoxy)ethyl]-4-iminobut-2-enamide |
|---|---|
| PubChem CID | 156525523 |
| Molecular Formula | C15H13F3N4O3 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (E)-3-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-N-[2-(3-fluorophenoxy)ethyl]-4-iminobut-2-enamide |
| SMILES | [H]/N=C/C(=C\C(=O)NCCOc1cccc(F)c1)c1nnc(C(F)F)o1 |
| InChI | InChI=1S/C15H13F3N4O3/c16-10-2-1-3-11(7-10)24-5-4-20-12(23)6-9(8-19)14-21-22-15(25-14)13(17)18/h1-3,6-8,13,19H,4-5H2,(H,20,23)/b9-6+,19-8+ |
| InChIKey | UCZOBPGFHKBFSP-PQISYLNESA-N |
| XLogP | 2.37 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|