C17H15BrClN3O — CID 156526138
7-bromo-N-[(4-chlorophenyl)methyl]-1,6-dimethylindazole-3-carboxamide (PubChem CID 156526138) has the molecular formula C17H15BrClN3O and a molecular weight of 392.68 g/mol. Its IUPAC name is 7-bromo-N-[(4-chlorophenyl)methyl]-1,6-dimethylindazole-3-carboxamide.
| Compound Name | 7-bromo-N-[(4-chlorophenyl)methyl]-1,6-dimethylindazole-3-carboxamide |
|---|---|
| PubChem CID | 156526138 |
| Molecular Formula | C17H15BrClN3O |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 7-bromo-N-[(4-chlorophenyl)methyl]-1,6-dimethylindazole-3-carboxamide |
| SMILES | Cc1ccc2c(C(=O)NCc3ccc(Cl)cc3)nn(C)c2c1Br |
| InChI | InChI=1S/C17H15BrClN3O/c1-10-3-8-13-15(21-22(2)16(13)14(10)18)17(23)20-9-11-4-6-12(19)7-5-11/h3-8H,9H2,1-2H3,(H,20,23) |
| InChIKey | PFOCEFOVVTYOSP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |