C18H18F12O2 — CID 156526172
1-[1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-(1-hydroxycyclohex-3-en-1-yl)hexyl]cyclohex-3-en-1-ol (PubChem CID 156526172) has the molecular formula C18H18F12O2 and a molecular weight of 494.32 g/mol. Its IUPAC name is 1-[1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-(1-hydroxycyclohex-3-en-1-yl)hexyl]cyclohex-3-en-1-ol.
| Compound Name | 1-[1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-(1-hydroxycyclohex-3-en-1-yl)hexyl]cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 156526172 |
| Molecular Formula | C18H18F12O2 |
| Molecular Weight | 494.32 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 1-[1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-6-(1-hydroxycyclohex-3-en-1-yl)hexyl]cyclohex-3-en-1-ol |
| SMILES | OC1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(O)CC=CCC2)CC=CCC1 |
| InChI | InChI=1S/C18H18F12O2/c19-13(20,11(31)7-3-1-4-8-11)15(23,24)17(27,28)18(29,30)16(25,26)14(21,22)12(32)9-5-2-6-10-12/h1-3,5,31-32H,4,6-10H2 |
| InChIKey | OYKKZVBZELTMPM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.32 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|