C31H14F6O7 — CID 156526567
4-[2-[3,5-bis(trifluoromethyl)phenyl]-3-(1,3-dioxoinden-4-yl)oxyphenoxy]-2-benzofuran-1,3-dione (PubChem CID 156526567) has the molecular formula C31H14F6O7 and a molecular weight of 612.43 g/mol. Its IUPAC name is 4-[2-[3,5-bis(trifluoromethyl)phenyl]-3-(1,3-dioxoinden-4-yl)oxyphenoxy]-2-benzofuran-1,3-dione.
| Compound Name | 4-[2-[3,5-bis(trifluoromethyl)phenyl]-3-(1,3-dioxoinden-4-yl)oxyphenoxy]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 156526567 |
| Molecular Formula | C31H14F6O7 |
| Molecular Weight | 612.43 g/mol |
| Exact Mass | 612.06 |
| IUPAC Name | 4-[2-[3,5-bis(trifluoromethyl)phenyl]-3-(1,3-dioxoinden-4-yl)oxyphenoxy]-2-benzofuran-1,3-dione |
| SMILES | O=C1CC(=O)c2c(Oc3cccc(Oc4cccc5c4C(=O)OC5=O)c3-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cccc21 |
| InChI | InChI=1S/C31H14F6O7/c32-30(33,34)15-10-14(11-16(12-15)31(35,36)37)25-21(42-23-6-1-4-17-19(38)13-20(39)26(17)23)8-3-9-22(25)43-24-7-2-5-18-27(24)29(41)44-28(18)40/h1-12H,13H2 |
| InChIKey | WOOCZUNSHVRWMM-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.43 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|