C27H30N6OS — CID 156526834
4-[4-[[(1R)-1-[5-[(2Z,4Z)-2-methyl-1-(methylamino)hepta-2,4-dien-6-yn-3-yl]thiophen-2-yl]ethyl]amino]phthalazin-6-yl]piperazin-2-one (PubChem CID 156526834) has the molecular formula C27H30N6OS and a molecular weight of 486.65 g/mol. Its IUPAC name is 4-[4-[[(1R)-1-[5-[(2Z,4Z)-2-methyl-1-(methylamino)hepta-2,4-dien-6-yn-3-yl]thiophen-2-yl]ethyl]amino]phthalazin-6-yl]piperazin-2-one.
| Compound Name | 4-[4-[[(1R)-1-[5-[(2Z,4Z)-2-methyl-1-(methylamino)hepta-2,4-dien-6-yn-3-yl]thiophen-2-yl]ethyl]amino]phthalazin-6-yl]piperazin-2-one |
|---|---|
| PubChem CID | 156526834 |
| Molecular Formula | C27H30N6OS |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 4-[4-[[(1R)-1-[5-[(2Z,4Z)-2-methyl-1-(methylamino)hepta-2,4-dien-6-yn-3-yl]thiophen-2-yl]ethyl]amino]phthalazin-6-yl]piperazin-2-one |
| SMILES | C#C/C=C\C(=C(/C)CNC)c1ccc([C@@H](C)Nc2nncc3ccc(N4CCNC(=O)C4)cc23)s1 |
| InChI | InChI=1S/C27H30N6OS/c1-5-6-7-22(18(2)15-28-4)25-11-10-24(35-25)19(3)31-27-23-14-21(9-8-20(23)16-30-32-27)33-13-12-29-26(34)17-33/h1,6-11,14,16,19,28H,12-13,15,17H2,2-4H3,(H,29,34)(H,31,32)/b7-6-,22-18-/t19-/m1/s1 |
| InChIKey | SOPMWAMHRHIEOL-FOTZIZRWSA-N |
| XLogP | 3.98 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|