C25H27F3N8 — CID 156526941
3-[(S)-amino-[[4-methyl-7-[(1R,4R)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrido[3,4-d]pyridazin-1-yl]amino]methyl]-2-methylbenzonitrile (PubChem CID 156526941) has the molecular formula C25H27F3N8 and a molecular weight of 496.54 g/mol. Its IUPAC name is 3-[(S)-amino-[[4-methyl-7-[(1R,4R)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrido[3,4-d]pyridazin-1-yl]amino]methyl]-2-methylbenzonitrile.
| Compound Name | 3-[(S)-amino-[[4-methyl-7-[(1R,4R)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrido[3,4-d]pyridazin-1-yl]amino]methyl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 156526941 |
| Molecular Formula | C25H27F3N8 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 3-[(S)-amino-[[4-methyl-7-[(1R,4R)-5-(2,2,2-trifluoroethyl)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrido[3,4-d]pyridazin-1-yl]amino]methyl]-2-methylbenzonitrile |
| SMILES | Cc1c(C#N)cccc1[C@@H](N)Nc1nnc(C)c2cnc(N3C[C@H]4CC[C@@H]3CN4CC(F)(F)F)cc12 |
| InChI | InChI=1S/C25H27F3N8/c1-14-16(9-29)4-3-5-19(14)23(30)32-24-20-8-22(31-10-21(20)15(2)33-34-24)36-12-17-6-7-18(36)11-35(17)13-25(26,27)28/h3-5,8,10,17-18,23H,6-7,11-13,30H2,1-2H3,(H,32,34)/t17-,18-,23+/m1/s1 |
| InChIKey | DARHFERMCQCLRT-PNCHPQGNSA-N |
| XLogP | 3.80 |
| TPSA | 106.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|