C25H28F3N5O — CID 156527097
7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-4-methylphthalazin-1-amine (PubChem CID 156527097) has the molecular formula C25H28F3N5O and a molecular weight of 471.53 g/mol. Its IUPAC name is 7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-4-methylphthalazin-1-amine.
| Compound Name | 7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-4-methylphthalazin-1-amine |
|---|---|
| PubChem CID | 156527097 |
| Molecular Formula | C25H28F3N5O |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-4-methylphthalazin-1-amine |
| SMILES | Cc1nnc(N[C@H](C)c2cccc(C(F)F)c2F)c2cc(N3CCN4CCOC[C@@H]4C3)ccc12 |
| InChI | InChI=1S/C25H28F3N5O/c1-15(20-4-3-5-21(23(20)26)24(27)28)29-25-22-12-17(6-7-19(22)16(2)30-31-25)33-9-8-32-10-11-34-14-18(32)13-33/h3-7,12,15,18,24H,8-11,13-14H2,1-2H3,(H,29,31)/t15-,18+/m1/s1 |
| InChIKey | QIABPDTUSRPQDA-QAPCUYQASA-N |
| XLogP | 4.71 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |