C26H32F3N7O2 — CID 156527195
1-[3-[(S)-[[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]amino]-aminomethyl]-2-fluorophenyl]-1,1-difluoro-2-methylpropan-2-ol (PubChem CID 156527195) has the molecular formula C26H32F3N7O2 and a molecular weight of 531.58 g/mol. Its IUPAC name is 1-[3-[(S)-[[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]amino]-aminomethyl]-2-fluorophenyl]-1,1-difluoro-2-methylpropan-2-ol.
| Compound Name | 1-[3-[(S)-[[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]amino]-aminomethyl]-2-fluorophenyl]-1,1-difluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 156527195 |
| Molecular Formula | C26H32F3N7O2 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 1-[3-[(S)-[[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]amino]-aminomethyl]-2-fluorophenyl]-1,1-difluoro-2-methylpropan-2-ol |
| SMILES | Cc1nnc(N[C@H](N)c2cccc(C(F)(F)C(C)(C)O)c2F)c2cc(N3CCN4CCOC[C@@H]4C3)ncc12 |
| InChI | InChI=1S/C26H32F3N7O2/c1-15-19-12-31-21(36-8-7-35-9-10-38-14-16(35)13-36)11-18(19)24(34-33-15)32-23(30)17-5-4-6-20(22(17)27)26(28,29)25(2,3)37/h4-6,11-12,16,23,37H,7-10,13-14,30H2,1-3H3,(H,32,34)/t16-,23-/m0/s1 |
| InChIKey | NVTUJOPJXUAUQV-HJPURHCSSA-N |
| XLogP | 2.93 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|