About 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine
3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine (PubChem CID 156527456) has the molecular formula C8H16N2O2S
and a molecular weight of 204.29 g/mol. Its IUPAC name is 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine |
| PubChem CID | 156527456 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine |
| SMILES | CC1=CCN(S(=O)(=O)CCCN)C1 |
| InChI | InChI=1S/C8H16N2O2S/c1-8-3-5-10(7-8)13(11,12)6-2-4-9/h3H,2,4-7,9H2,1H3 |
| InChIKey | DHSSWKSNMDRKJF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine?
The IUPAC name of 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine (CID 156527456) is 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine.
What is the SMILES notation for 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine?
The canonical SMILES for 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine is CC1=CCN(S(=O)(=O)CCCN)C1.
What is the InChIKey of 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine?
The InChIKey is DHSSWKSNMDRKJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2S/c1-8-3-5-10(7-8)13(11,12)6-2-4-9/h3H,2,4-7,9H2,1H3.
What are the key properties of 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine?
3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine has a molecular weight of 204.29 g/mol, XLogP of -0.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-methyl-2,5-dihydropyrrol-1-yl)sulfonyl]propan-1-amine is sourced from PubChem (CID 156527456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).