About N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide
N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide (PubChem CID 156527892) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide |
| PubChem CID | 156527892 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide |
| SMILES | CC(=O)NCC1=CN(C)N(C)N1 |
| InChI | InChI=1S/C7H14N4O/c1-6(12)8-4-7-5-10(2)11(3)9-7/h5,9H,4H2,1-3H3,(H,8,12) |
| InChIKey | RPCARUXWIBDVFL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide?
The IUPAC name of N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide (CID 156527892) is N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide.
What is the SMILES notation for N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide?
The canonical SMILES for N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide is CC(=O)NCC1=CN(C)N(C)N1.
What is the InChIKey of N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide?
The InChIKey is RPCARUXWIBDVFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c1-6(12)8-4-7-5-10(2)11(3)9-7/h5,9H,4H2,1-3H3,(H,8,12).
What are the key properties of N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide?
N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide has a molecular weight of 170.22 g/mol, XLogP of -0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,3-dimethyl-1H-triazol-5-yl)methyl]acetamide is sourced from PubChem (CID 156527892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).