C19H27IN6O2 — CID 156527999
4-[6-[(2-amino-6-iodo-1,3-diazinan-4-yl)amino]-3-oxo-1H-isoindol-2-yl]-N-ethenylpentanamide (PubChem CID 156527999) has the molecular formula C19H27IN6O2 and a molecular weight of 498.37 g/mol. Its IUPAC name is 4-[6-[(2-amino-6-iodo-1,3-diazinan-4-yl)amino]-3-oxo-1H-isoindol-2-yl]-N-ethenylpentanamide.
| Compound Name | 4-[6-[(2-amino-6-iodo-1,3-diazinan-4-yl)amino]-3-oxo-1H-isoindol-2-yl]-N-ethenylpentanamide |
|---|---|
| PubChem CID | 156527999 |
| Molecular Formula | C19H27IN6O2 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 4-[6-[(2-amino-6-iodo-1,3-diazinan-4-yl)amino]-3-oxo-1H-isoindol-2-yl]-N-ethenylpentanamide |
| SMILES | C=CNC(=O)CCC(C)N1Cc2cc(NC3CC(I)NC(N)N3)ccc2C1=O |
| InChI | InChI=1S/C19H27IN6O2/c1-3-22-17(27)7-4-11(2)26-10-12-8-13(5-6-14(12)18(26)28)23-16-9-15(20)24-19(21)25-16/h3,5-6,8,11,15-16,19,23-25H,1,4,7,9-10,21H2,2H3,(H,22,27) |
| InChIKey | RPUUCECULDEBCU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|