C32H30O5 — CID 156528169
[(3aR,4R,6aS)-4-[(E,4R)-4-(3-methylphenyl)-3-oxopent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (PubChem CID 156528169) has the molecular formula C32H30O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-[(E,4R)-4-(3-methylphenyl)-3-oxopent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate.
| Compound Name | [(3aR,4R,6aS)-4-[(E,4R)-4-(3-methylphenyl)-3-oxopent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 156528169 |
| Molecular Formula | C32H30O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | [(3aR,4R,6aS)-4-[(E,4R)-4-(3-methylphenyl)-3-oxopent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| SMILES | Cc1cccc([C@@H](C)C(=O)/C=C/[C@H]2C(OC(=O)c3ccc(-c4ccccc4)cc3)C[C@@H]3OC(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C32H30O5/c1-20-7-6-10-25(17-20)21(2)28(33)16-15-26-27-18-31(34)36-30(27)19-29(26)37-32(35)24-13-11-23(12-14-24)22-8-4-3-5-9-22/h3-17,21,26-27,29-30H,18-19H2,1-2H3/b16-15+/t21-,26-,27-,29?,30+/m1/s1 |
| InChIKey | AGDBFDVJBUQZMN-VUPKFHGUSA-N |
| XLogP | 6.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|