C16H19F6N3O5S2 — CID 156529378
2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-[methyl(1,3-thiazol-2-ylsulfonyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid (PubChem CID 156529378) has the molecular formula C16H19F6N3O5S2 and a molecular weight of 511.47 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-[methyl(1,3-thiazol-2-ylsulfonyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-[methyl(1,3-thiazol-2-ylsulfonyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 156529378 |
| Molecular Formula | C16H19F6N3O5S2 |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-[methyl(1,3-thiazol-2-ylsulfonyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid |
| SMILES | CN(C1CC2(CCN(C(=O)O)CC2)OC1C(C(F)(F)F)C(F)(F)F)S(=O)(=O)c1nccs1 |
| InChI | InChI=1S/C16H19F6N3O5S2/c1-24(32(28,29)12-23-4-7-31-12)9-8-14(2-5-25(6-3-14)13(26)27)30-10(9)11(15(17,18)19)16(20,21)22/h4,7,9-11H,2-3,5-6,8H2,1H3,(H,26,27) |
| InChIKey | WTQXNAZIEZWTOY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |