C12H18N2 — CID 156529425
N'-(cyclopropylmethyl)-N'-methyl-1-phenylmethanediamine (PubChem CID 156529425) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N'-(cyclopropylmethyl)-N'-methyl-1-phenylmethanediamine.
| Compound Name | N'-(cyclopropylmethyl)-N'-methyl-1-phenylmethanediamine |
|---|---|
| PubChem CID | 156529425 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N'-(cyclopropylmethyl)-N'-methyl-1-phenylmethanediamine |
| SMILES | CN(CC1CC1)C(N)c1ccccc1 |
| InChI | InChI=1S/C12H18N2/c1-14(9-10-7-8-10)12(13)11-5-3-2-4-6-11/h2-6,10,12H,7-9,13H2,1H3 |
| InChIKey | VWYBHJSDXASUTL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|