C24H27F3O8 — CID 156529561
methyl (2R,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-6a,10b-dimethyl-4,10-dioxo-2-[5-(trifluoromethyl)furan-3-yl]-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 156529561) has the molecular formula C24H27F3O8 and a molecular weight of 500.47 g/mol. Its IUPAC name is methyl (2R,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-6a,10b-dimethyl-4,10-dioxo-2-[5-(trifluoromethyl)furan-3-yl]-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (2R,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-6a,10b-dimethyl-4,10-dioxo-2-[5-(trifluoromethyl)furan-3-yl]-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 156529561 |
| Molecular Formula | C24H27F3O8 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | methyl (2R,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-6a,10b-dimethyl-4,10-dioxo-2-[5-(trifluoromethyl)furan-3-yl]-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC(C)=O)C(=O)[C@H]2[C@@]1(C)CC[C@H]1C(=O)O[C@@H](c3coc(C(F)(F)F)c3)C[C@]21C |
| InChI | InChI=1S/C24H27F3O8/c1-11(28)34-15-8-14(20(30)32-4)22(2)6-5-13-21(31)35-16(9-23(13,3)19(22)18(15)29)12-7-17(33-10-12)24(25,26)27/h7,10,13-16,19H,5-6,8-9H2,1-4H3/t13-,14-,15-,16+,19-,22-,23-/m0/s1 |
| InChIKey | WVIOCDOZFLIBPZ-HZBZECPFSA-N |
| XLogP | 4.02 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|