C27H28N8 — CID 156529616
1-[4-[3-[5-(diaminomethylideneamino)-3H-indol-2-yl]-1H-indol-5-yl]phenyl]-1,3,3-trimethylguanidine (PubChem CID 156529616) has the molecular formula C27H28N8 and a molecular weight of 464.58 g/mol. Its IUPAC name is 1-[4-[3-[5-(diaminomethylideneamino)-3H-indol-2-yl]-1H-indol-5-yl]phenyl]-1,3,3-trimethylguanidine.
| Compound Name | 1-[4-[3-[5-(diaminomethylideneamino)-3H-indol-2-yl]-1H-indol-5-yl]phenyl]-1,3,3-trimethylguanidine |
|---|---|
| PubChem CID | 156529616 |
| Molecular Formula | C27H28N8 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 1-[4-[3-[5-(diaminomethylideneamino)-3H-indol-2-yl]-1H-indol-5-yl]phenyl]-1,3,3-trimethylguanidine |
| SMILES | [H]/N=C(\N(C)C)N(C)c1ccc(-c2ccc3[nH]cc(C4=Nc5ccc(N=C(N)N)cc5C4)c3c2)cc1 |
| InChI | InChI=1S/C27H28N8/c1-34(2)27(30)35(3)20-8-4-16(5-9-20)17-6-10-24-21(13-17)22(15-31-24)25-14-18-12-19(32-26(28)29)7-11-23(18)33-25/h4-13,15,30-31H,14H2,1-3H3,(H4,28,29,32)/b30-27+ |
| InChIKey | WQTFLHFCVMYSQX-KDJFERLWSA-N |
| XLogP | 4.35 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|