C17H19ClIN3O4S2 — CID 156530061
[2-[3-[2-(4-amino-1-iodobutan-2-yl)-1,3-thiazol-4-yl]-4,5-dihydro-1,2-oxazol-5-yl]-3-chlorophenyl] methanesulfonate (PubChem CID 156530061) has the molecular formula C17H19ClIN3O4S2 and a molecular weight of 555.85 g/mol. Its IUPAC name is [2-[3-[2-(4-amino-1-iodobutan-2-yl)-1,3-thiazol-4-yl]-4,5-dihydro-1,2-oxazol-5-yl]-3-chlorophenyl] methanesulfonate.
| Compound Name | [2-[3-[2-(4-amino-1-iodobutan-2-yl)-1,3-thiazol-4-yl]-4,5-dihydro-1,2-oxazol-5-yl]-3-chlorophenyl] methanesulfonate |
|---|---|
| PubChem CID | 156530061 |
| Molecular Formula | C17H19ClIN3O4S2 |
| Molecular Weight | 555.85 g/mol |
| Exact Mass | 554.96 |
| IUPAC Name | [2-[3-[2-(4-amino-1-iodobutan-2-yl)-1,3-thiazol-4-yl]-4,5-dihydro-1,2-oxazol-5-yl]-3-chlorophenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cccc(Cl)c1C1CC(c2csc(C(CI)CCN)n2)=NO1 |
| InChI | InChI=1S/C17H19ClIN3O4S2/c1-28(23,24)26-14-4-2-3-11(18)16(14)15-7-12(22-25-15)13-9-27-17(21-13)10(8-19)5-6-20/h2-4,9-10,15H,5-8,20H2,1H3 |
| InChIKey | SZUOOQKLLPTNCG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.85 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|