About N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride
N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride (PubChem CID 156530281) has the molecular formula C20H16ClN3
and a molecular weight of 333.82 g/mol. Its IUPAC name is N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride.
Molecular Properties
| Compound Name | N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride |
| PubChem CID | 156530281 |
| Molecular Formula | C20H16ClN3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride |
| SMILES | [H]/N=C(\N=C(\N)Cl)c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H16ClN3/c21-20(23)24-19(22)18-12-16(14-7-3-1-4-8-14)11-17(13-18)15-9-5-2-6-10-15/h1-13H,(H3,22,23,24) |
| InChIKey | LTHALMCNZHERJE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride?
The IUPAC name of N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride (CID 156530281) is N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride.
What is the SMILES notation for N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride?
The canonical SMILES for N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride is [H]/N=C(\N=C(\N)Cl)c1cc(-c2ccccc2)cc(-c2ccccc2)c1.
What is the InChIKey of N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride?
The InChIKey is LTHALMCNZHERJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3/c21-20(23)24-19(22)18-12-16(14-7-3-1-4-8-14)11-17(13-18)15-9-5-2-6-10-15/h1-13H,(H3,22,23,24).
What are the key properties of N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride?
N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride has a molecular weight of 333.82 g/mol, XLogP of 4.90, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,5-diphenylbenzenecarboximidoyl)carbamimidoyl chloride is sourced from PubChem (CID 156530281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).