C16H25F3N2O4 — CID 156530985
N-[2-[2-[[2-[(2Z)-cyclooct-2-en-1-yl]oxyacetyl]amino]ethoxy]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 156530985) has the molecular formula C16H25F3N2O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is N-[2-[2-[[2-[(2Z)-cyclooct-2-en-1-yl]oxyacetyl]amino]ethoxy]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[2-[[2-[(2Z)-cyclooct-2-en-1-yl]oxyacetyl]amino]ethoxy]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 156530985 |
| Molecular Formula | C16H25F3N2O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-[2-[2-[[2-[(2Z)-cyclooct-2-en-1-yl]oxyacetyl]amino]ethoxy]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(COC1/C=C\CCCCC1)NCCOCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H25F3N2O4/c17-16(18,19)15(23)21-9-11-24-10-8-20-14(22)12-25-13-6-4-2-1-3-5-7-13/h4,6,13H,1-3,5,7-12H2,(H,20,22)(H,21,23)/b6-4- |
| InChIKey | UJZYQGHQAXXGNE-XQRVVYSFSA-N |
| XLogP | 1.70 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|