About N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide
N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide (PubChem CID 156531443) has the molecular formula C14H21N5O2
and a molecular weight of 291.36 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide |
| PubChem CID | 156531443 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide |
| SMILES | CC1(C(=O)NCCOCCN)C=CC=C(CN=[N+]=[N-])C=C1 |
| InChI | InChI=1S/C14H21N5O2/c1-14(13(20)17-8-10-21-9-7-15)5-2-3-12(4-6-14)11-18-19-16/h2-6H,7-11,15H2,1H3,(H,17,20) |
| InChIKey | LSXKWEUJICTOPS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide?
The IUPAC name of N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide (CID 156531443) is N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide.
What is the SMILES notation for N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide?
The canonical SMILES for N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide is CC1(C(=O)NCCOCCN)C=CC=C(CN=[N+]=[N-])C=C1.
What is the InChIKey of N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide?
The InChIKey is LSXKWEUJICTOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O2/c1-14(13(20)17-8-10-21-9-7-15)5-2-3-12(4-6-14)11-18-19-16/h2-6H,7-11,15H2,1H3,(H,17,20).
What are the key properties of N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide?
N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide has a molecular weight of 291.36 g/mol, XLogP of 1.45, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-aminoethoxy)ethyl]-4-(azidomethyl)-1-methylcyclohepta-2,4,6-triene-1-carboxamide is sourced from PubChem (CID 156531443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).