About 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol
3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol (PubChem CID 156531517) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol.
Molecular Properties
| Compound Name | 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol |
| PubChem CID | 156531517 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol |
| SMILES | C=C(O)C(N)CCC1=CC=CCC=C1 |
| InChI | InChI=1S/C12H17NO/c1-10(14)12(13)9-8-11-6-4-2-3-5-7-11/h2,4-7,12,14H,1,3,8-9,13H2 |
| InChIKey | CJRMNGRBUNGBFA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol?
The IUPAC name of 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol (CID 156531517) is 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol.
What is the SMILES notation for 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol?
The canonical SMILES for 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol is C=C(O)C(N)CCC1=CC=CCC=C1.
What is the InChIKey of 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol?
The InChIKey is CJRMNGRBUNGBFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-10(14)12(13)9-8-11-6-4-2-3-5-7-11/h2,4-7,12,14H,1,3,8-9,13H2.
What are the key properties of 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol?
3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol has a molecular weight of 191.27 g/mol, XLogP of 2.61, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-cyclohepta-1,3,6-trien-1-ylpent-1-en-2-ol is sourced from PubChem (CID 156531517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).