About N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide
N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide (PubChem CID 156531687) has the molecular formula C10H17N3O2S2
and a molecular weight of 275.40 g/mol. Its IUPAC name is N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide.
Molecular Properties
| Compound Name | N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide |
| PubChem CID | 156531687 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide |
| SMILES | Cc1csc(S(N)(=O)=NC(=O)CCC(C)C)n1 |
| InChI | InChI=1S/C10H17N3O2S2/c1-7(2)4-5-9(14)13-17(11,15)10-12-8(3)6-16-10/h6-7H,4-5H2,1-3H3,(H2,11,13,14,15) |
| InChIKey | JZAZOEMTPWGYOY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide?
The IUPAC name of N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide (CID 156531687) is N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide.
What is the SMILES notation for N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide?
The canonical SMILES for N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide is Cc1csc(S(N)(=O)=NC(=O)CCC(C)C)n1.
What is the InChIKey of N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide?
The InChIKey is JZAZOEMTPWGYOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2S2/c1-7(2)4-5-9(14)13-17(11,15)10-12-8(3)6-16-10/h6-7H,4-5H2,1-3H3,(H2,11,13,14,15).
What are the key properties of N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide?
N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide has a molecular weight of 275.40 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[amino-(4-methyl-1,3-thiazol-2-yl)-oxo-λ6-sulfanylidene]-4-methylpentanamide is sourced from PubChem (CID 156531687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).