C34H54FN7O3S — CID 156531789
N-ethyl-5-fluoro-2-[[5-[2-[(5S)-6-[2-methoxyethyl(methyl)amino]-2,2,5-trimethyl-3-sulfanylhexan-3-yl]-2,7-diazaspiro[3.4]octan-7-yl]-1,2,4-triazin-6-yl]oxy]-N-propan-2-ylbenzamide (PubChem CID 156531789) has the molecular formula C34H54FN7O3S and a molecular weight of 659.92 g/mol. Its IUPAC name is N-ethyl-5-fluoro-2-[[5-[2-[(5S)-6-[2-methoxyethyl(methyl)amino]-2,2,5-trimethyl-3-sulfanylhexan-3-yl]-2,7-diazaspiro[3.4]octan-7-yl]-1,2,4-triazin-6-yl]oxy]-N-propan-2-ylbenzamide.
| Compound Name | N-ethyl-5-fluoro-2-[[5-[2-[(5S)-6-[2-methoxyethyl(methyl)amino]-2,2,5-trimethyl-3-sulfanylhexan-3-yl]-2,7-diazaspiro[3.4]octan-7-yl]-1,2,4-triazin-6-yl]oxy]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 156531789 |
| Molecular Formula | C34H54FN7O3S |
| Molecular Weight | 659.92 g/mol |
| Exact Mass | 659.40 |
| IUPAC Name | N-ethyl-5-fluoro-2-[[5-[2-[(5S)-6-[2-methoxyethyl(methyl)amino]-2,2,5-trimethyl-3-sulfanylhexan-3-yl]-2,7-diazaspiro[3.4]octan-7-yl]-1,2,4-triazin-6-yl]oxy]-N-propan-2-ylbenzamide |
| SMILES | CCN(C(=O)c1cc(F)ccc1Oc1nncnc1N1CCC2(C1)CN(C(S)(C[C@H](C)CN(C)CCOC)C(C)(C)C)C2)C(C)C |
| InChI | InChI=1S/C34H54FN7O3S/c1-10-42(24(2)3)31(43)27-17-26(35)11-12-28(27)45-30-29(36-23-37-38-30)40-14-13-33(20-40)21-41(22-33)34(46,32(5,6)7)18-25(4)19-39(8)15-16-44-9/h11-12,17,23-25,46H,10,13-16,18-22H2,1-9H3/t25-,34?/m0/s1 |
| InChIKey | GPULPLSJZDTUBB-VOTTXDMFSA-N |
| XLogP | 5.46 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.92 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|