C8H10FI — CID 156532070
(3E,5Z)-4-fluoro-2-iodo-5-methylhepta-1,3,5-triene (PubChem CID 156532070) has the molecular formula C8H10FI and a molecular weight of 252.07 g/mol. Its IUPAC name is (3E,5Z)-4-fluoro-2-iodo-5-methylhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-4-fluoro-2-iodo-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 156532070 |
| Molecular Formula | C8H10FI |
| Molecular Weight | 252.07 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | (3E,5Z)-4-fluoro-2-iodo-5-methylhepta-1,3,5-triene |
| SMILES | C=C(I)/C=C(F)\C(C)=C/C |
| InChI | InChI=1S/C8H10FI/c1-4-6(2)8(9)5-7(3)10/h4-5H,3H2,1-2H3/b6-4-,8-5+ |
| InChIKey | NWRHTLQVTLDJBK-QXMOYCCXSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.07 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|